CAS 91682-96-1

Stigmatellin

Description:

Stigmatellin is a chemical compound classified as a natural product, specifically a type of quinone. It is primarily known for its role as a potent inhibitor of the mitochondrial respiratory chain, particularly affecting complex III, which is crucial for cellular respiration and energy production. Stigmatellin is derived from certain fungi, notably from the genus Stigmatella, and exhibits a unique structure that contributes to its biological activity. The compound has garnered interest in pharmacological research due to its potential applications in studying mitochondrial function and its implications in various diseases. Additionally, Stigmatellin's ability to modulate cellular processes makes it a valuable tool in biochemical studies. Its CAS number, 91682-96-1, is used for identification in chemical databases and regulatory contexts. Overall, Stigmatellin represents an important compound in the field of biochemistry and pharmacology, with ongoing research exploring its mechanisms and potential therapeutic uses.

Formula: C₃₀H₄₂O₇

InChI: InChI=1S/C30H42O7/c1-10-18(2)13-11-12-14-22(33-6)21(5)29(36-9)19(3)15-16-23-20(4)27(31)26-24(34-7)17-25(35-8)28(32)30(26)37-23/h10-14,17,19,21-22,29,32H,15-16H2,1-9H3

InChI key: InChIKey=UZHDGDDPOPDJGM-UHFFFAOYSA-N

SMILES: O(C)C1=C2C(OC(CCC(C(C(C(C=CC=CC(=CC)C)OC)C)OC)C)=C(C)C2=O)=C(O)C(OC)=C1

Synonyms:

• 2-(4,6-Dimethoxy-3,5,11-trimethyl-7,9,11-tridecatrien-1-yl)-8-hydroxy-5,7-dimethoxy-3-methyl-4H-1-benzopyran-4-one
• 4H-1-Benzopyran-4-one, 2-(4,6-dimethoxy-3,5,11-trimethyl-7,9,11-tridecatrienyl)-8-hydroxy-5,7-dimethoxy-3-methyl-
• Stigmatellin
• 4H-1-Benzopyran-4-one, 2-(4,6-dimethoxy-3,5,11-trimethyl-7,9,11-tridecatrien-1-yl)-8-hydroxy-5,7-dimethoxy-3-methyl-

Stigmatellin

CAS: 91682-96-1

Stigmatellin is an antibiotic derived from the cell mass of the myxobacterium, effective against yeasts (yeasts), filamentous fungi (filamentous fungi), and several Gram-positive bacteria (Gram-positive bacteria). Additionally, it serves as a potent inhibitor of photosynthetic electron (photosynthetic electron) transfer. Stigmatellin utilizes various sugars, polysaccharides, and acids from the citric acid cycle as substrates, inhibiting RNA and protein synthesis. It has two different inhibitory sites: one located on the reducing side of photosystem II and the other at the cytochrome b6/f complex. Stigmatellin holds potential for use in antimicrobial and photosynthesis research.

Formula: C₃₀H₄₂O₇

Color and Shape: Solid

Molecular weight: 514.65

Ref: TM-TN8168