CymitQuimica logo

CAS 916824-56-1

:

4-Bromo-2-(4-methylphenyl)pyridine

Description:
4-Bromo-2-(4-methylphenyl)pyridine is an organic compound characterized by its pyridine ring, which is a six-membered aromatic heterocycle containing one nitrogen atom. The presence of a bromine atom at the 4-position and a para-methylphenyl group at the 2-position contributes to its unique chemical properties. This compound typically exhibits moderate solubility in organic solvents and may have limited solubility in water due to its hydrophobic aromatic components. It is likely to participate in various chemical reactions, including electrophilic substitutions and nucleophilic attacks, owing to the electron-withdrawing nature of the bromine atom and the electron-donating properties of the methylphenyl group. The compound may also display biological activity, making it of interest in medicinal chemistry and drug development. Safety data should be consulted for handling and storage, as halogenated compounds can pose environmental and health risks. Overall, 4-Bromo-2-(4-methylphenyl)pyridine is a versatile compound with potential applications in various fields of chemistry and pharmacology.
Formula:C12H10BrN
InChI:InChI=1S/C12H10BrN/c1-9-2-4-10(5-3-9)12-8-11(13)6-7-14-12/h2-8H,1H3
InChI key:InChIKey=PRJQTPVITNKPPP-UHFFFAOYSA-N
SMILES:BrC=1C=C(N=CC1)C2=CC=C(C)C=C2
Synonyms:
  • 4-Bromo-2-(4-methylphenyl)pyridine
  • Pyridine, 4-bromo-2-(4-methylphenyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.