CymitQuimica logo

CAS 916824-57-2

:

4-Bromo-2-(4-fluorophenyl)pyridine

Description:
4-Bromo-2-(4-fluorophenyl)pyridine is an organic compound characterized by its pyridine ring, which is a six-membered aromatic heterocycle containing one nitrogen atom. The presence of a bromine atom at the 4-position and a para-fluorophenyl group at the 2-position contributes to its unique chemical properties. This compound typically exhibits moderate to high lipophilicity due to the halogen substituents, which can influence its solubility in organic solvents. It may also display interesting reactivity patterns in electrophilic aromatic substitution reactions due to the electron-withdrawing nature of the bromine and fluorine atoms. Additionally, the compound's structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, as halogenated pyridines are often found in biologically active molecules. Its molecular interactions, stability, and reactivity can be further explored through various analytical techniques, including NMR spectroscopy and mass spectrometry, to understand its behavior in different chemical environments.
Formula:C11H7BrFN
InChI:InChI=1S/C11H7BrFN/c12-9-5-6-14-11(7-9)8-1-3-10(13)4-2-8/h1-7H
InChI key:InChIKey=WJFDGYZUBKOQNY-UHFFFAOYSA-N
SMILES:BrC=1C=C(N=CC1)C2=CC=C(F)C=C2
Synonyms:
  • Pyridine, 4-bromo-2-(4-fluorophenyl)-
  • 4-Bromo-2-(4-fluorophenyl)pyridine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.