CAS 916825-05-3

1-[amino-(2-hydroxyphenyl)methyl]naphthalen-2-ol; 2,2,2-trifluoroacetic acid

Description:

1-[Amino-(2-hydroxyphenyl)methyl]naphthalen-2-ol, also known as a derivative of naphthol, features a naphthalene core substituted with an amino group and a hydroxymethyl group, contributing to its potential as a biological or pharmaceutical agent. This compound exhibits characteristics typical of aromatic amines, including the ability to participate in hydrogen bonding due to the presence of hydroxyl and amino groups. Its structure suggests potential for interactions with biological targets, making it of interest in medicinal chemistry. The presence of the 2,2,2-trifluoroacetic acid moiety indicates that it may possess acidic properties, which can influence its solubility and reactivity in various environments. The trifluoroacetic acid group is known for enhancing the stability and lipophilicity of compounds, potentially affecting their pharmacokinetics. Overall, this compound's unique structural features suggest it may have applications in drug development or as a research tool in biochemical studies. However, specific properties such as solubility, melting point, and reactivity would need to be determined through experimental data.

Formula: C₁₉H₁₆F₃NO₄

InChI: InChI=1/C17H15NO2.C2HF3O2/c18-17(13-7-3-4-8-14(13)19)16-12-6-2-1-5-11(12)9-10-15(16)20;3-2(4,5)1(6)7/h1-10,17,19-20H,18H2;(H,6,7)

SMILES: c1ccc2c(c1)ccc(c2C(c1ccccc1O)N)O.C(=O)(C(F)(F)F)O

1-a-Amino(2-hydroxyphenyl)methyl-2-naphthol trifluoroacetate

CAS: 916825-05-3

1-a-Amino(2-hydroxyphenyl)methyl-2-naphthol trifluoroacetate

Purity: ≥95%

Molecular weight: 379.33g/mol

Ref: 54-PC404508