CymitQuimica logo

CAS 91687-60-4

:

2-methyl-N'-[(E)-(5-nitrofuran-2-yl)methylidene]-1,3-dioxolane-2-carbohydrazide

Description:
2-methyl-N'-[(E)-(5-nitrofuran-2-yl)methylidene]-1,3-dioxolane-2-carbohydrazide is a chemical compound characterized by its complex structure, which includes a dioxolane ring, a hydrazide functional group, and a nitrofuran moiety. The presence of the dioxolane ring contributes to its potential as a versatile building block in organic synthesis, while the nitrofuran group is known for its biological activity, particularly in antimicrobial and antitumor applications. The compound's hydrazide functionality may also impart reactivity, making it suitable for further derivatization. Its molecular structure suggests potential for hydrogen bonding and other intermolecular interactions, which could influence its solubility and stability in various solvents. The compound's unique combination of functional groups may lead to interesting pharmacological properties, warranting further investigation in medicinal chemistry. Overall, this substance exemplifies the intersection of organic synthesis and biological activity, making it a candidate for research in drug development and related fields.
Formula:C10H11N3O6
InChI:InChI=1/C10H11N3O6/c1-10(17-4-5-18-10)9(14)12-11-6-7-2-3-8(19-7)13(15)16/h2-3,6H,4-5H2,1H3,(H,12,14)/b11-6+
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.