CAS 91687-65-9

N-[(1R)-1-(4-bromophenyl)ethyl]-2-chloroacetamide

Description:

N-[(1R)-1-(4-bromophenyl)ethyl]-2-chloroacetamide is a chemical compound characterized by its amide functional group, which is derived from the reaction of a carboxylic acid and an amine. This compound features a chiral center, indicated by the (1R) configuration, which contributes to its stereochemistry and potential biological activity. The presence of a 4-bromophenyl group enhances its lipophilicity and may influence its interaction with biological targets. The 2-chloroacetamide moiety suggests potential reactivity, particularly in nucleophilic substitution reactions. This compound may exhibit pharmacological properties, making it of interest in medicinal chemistry. Its molecular structure suggests it could participate in various chemical reactions, including acylation and amide bond formation. Additionally, the bromine substituent can affect the compound's electronic properties and reactivity. Overall, N-[(1R)-1-(4-bromophenyl)ethyl]-2-chloroacetamide is a compound with potential applications in drug development and chemical synthesis, warranting further investigation into its properties and effects.

Formula: C₁₀H₁₁BrClNO

InChI: InChI=1/C10H11BrClNO/c1-7(13-10(14)6-12)8-2-4-9(11)5-3-8/h2-5,7H,6H2,1H3,(H,13,14)/t7-/m1/s1

SMILES: C[C@H](c1ccc(cc1)Br)N=C(CCl)O

N-(1-(4-Bromophenyl)ethyl)-2-chloroacetamide

CAS: 91687-65-9

N-(1-(4-Bromophenyl)ethyl)-2-chloroacetamide

Purity: 97%

Molecular weight: 276.56g/mol

Ref: 54-OR1055846