CAS 91687-71-7

2-(3-Bromophenoxy)-2-methylpropanoic acid

Description:

2-(3-Bromophenoxy)-2-methylpropanoic acid, with the CAS number 91687-71-7, is an organic compound characterized by its unique structure, which includes a bromophenyl group and a carboxylic acid functional group. This compound typically appears as a solid at room temperature and is soluble in organic solvents, while its solubility in water may vary depending on pH. The presence of the bromine atom enhances its reactivity and can influence its biological activity, making it of interest in pharmaceutical and agrochemical research. The carboxylic acid group contributes to its acidity and potential interactions in biological systems. Additionally, the compound may exhibit specific stereochemical properties due to the presence of the chiral center in the propanoic acid moiety, which can affect its pharmacokinetics and pharmacodynamics. Overall, 2-(3-Bromophenoxy)-2-methylpropanoic acid is a compound of interest for its potential applications in various fields, including medicinal chemistry and agricultural science.

Formula: C₁₀H₁₁BrO₃

InChI: InChI=1S/C10H11BrO3/c1-10(2,9(12)13)14-8-5-3-4-7(11)6-8/h3-6H,1-2H3,(H,12,13)

InChI key: InChIKey=PGOZZHTZOZAWGK-UHFFFAOYSA-N

SMILES: O(C(C(O)=O)(C)C)C1=CC(Br)=CC=C1

Synonyms:

• 2-(3-Bromophenoxy)-2-methylpropanoic acid
• Propionic acid, 2-(m-bromophenoxy)-2-methyl-
• 2-(3-Bromophenoxy)-2-methylpropionic acid
• Propanoic acid, 2-(3-bromophenoxy)-2-methyl-