CAS 916914-03-9

2-(Difluoromethyl)-1H-indole

Description:

2-(Difluoromethyl)-1H-indole is a chemical compound characterized by its indole structure, which consists of a fused benzene and pyrrole ring. The presence of a difluoromethyl group (-CF2H) at the 2-position of the indole ring significantly influences its chemical properties and reactivity. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. The difluoromethyl group can enhance the lipophilicity of the molecule, potentially affecting its biological activity and interactions with other substances. Additionally, the presence of fluorine atoms often imparts unique electronic properties, which can be advantageous in medicinal chemistry and material science. 2-(Difluoromethyl)-1H-indole may be of interest in pharmaceutical research due to its potential applications in drug development, particularly in targeting specific biological pathways. As with many fluorinated compounds, it is essential to consider its environmental impact and stability during synthesis and application.

Formula: C₉H₇F₂N

InChI: InChI=1/C9H7F2N/c10-9(11)8-5-6-3-1-2-4-7(6)12-8/h1-5,9,12H

SMILES: c1ccc2c(c1)cc(C(F)F)[nH]2