CymitQuimica logo

CAS 91696-95-6

:

Boric acid (H3BO3), reaction products with 2-amino-2-methyl-1-propanol

Description:
Boric acid (H3BO3) is a weak acid that exhibits unique properties, including its ability to act as a mild antiseptic and insecticide. It is often used in various applications, including pharmaceuticals and as a pH buffer. When boric acid reacts with 2-amino-2-methyl-1-propanol, a compound known for its role as a pH adjuster and stabilizer, the reaction typically leads to the formation of borate esters or complexes. These products can enhance the solubility and stability of formulations, particularly in aqueous solutions. The reaction may also result in the formation of a boron-nitrogen complex, which can exhibit different physical and chemical properties compared to the reactants. The resulting compounds may have applications in various fields, including cosmetics, pharmaceuticals, and materials science, due to their potential to modify the properties of the original substances. Overall, the interaction between boric acid and 2-amino-2-methyl-1-propanol highlights the versatility of boron-containing compounds in chemical synthesis and formulation chemistry.
Formula:C4H11NO·BH3O3
InChI:InChI=1S/C4H11NO.BH3O3/c1-4(2,5)3-6;2-1(3)4/h6H,3,5H2,1-2H3;2-4H
InChI key:InChIKey=DOWAMJWPBKRNNX-UHFFFAOYSA-N
SMILES:B(O)(O)O.C(CO)(C)(C)N
Synonyms:
  • Boric acid (H3BO3), reaction products with 2-amino-2-methyl-1-propanol
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.