CymitQuimica logo

CAS 91696-96-7

:

Boric acid (H3BO3), reaction products with diethanolamine, compds. with diethanolamine and ethanolamine

Description:
Boric acid (H3BO3) is a weak acid that exhibits unique properties, including its ability to act as a mild antiseptic and insecticide. When reacted with diethanolamine, boric acid can form various borate esters, which may enhance the solubility and stability of the resulting compounds. These reaction products often exhibit improved properties for applications in pharmaceuticals, cosmetics, and agricultural formulations. The interaction between boric acid and diethanolamine can lead to the formation of complex structures that may have enhanced biological activity or modified physical properties. Additionally, when ethanolamine is involved, similar borate compounds can be produced, potentially offering different characteristics based on the amine's structure. The compound associated with the CAS number 91696-96-7 is likely a specific derivative or complex formed from these interactions, which may possess unique functionalities suitable for specialized applications. Overall, the combination of boric acid with diethanolamine and ethanolamine highlights the versatility of boron-containing compounds in various chemical and industrial contexts.
Formula:C4H11NO2·C2H7NO·BH3O3
InChI:InChI=1S/C4H11NO2.C2H7NO.BH3O3/c6-3-1-5-2-4-7;3-1-2-4;2-1(3)4/h5-7H,1-4H2;4H,1-3H2;2-4H
InChI key:InChIKey=QUSGFSUQCSPKBW-UHFFFAOYSA-N
SMILES:B(O)(O)O.C(CO)N.N(CCO)CCO
Synonyms:
  • Boric acid (H3BO3), reaction products with diethanolamine, compds. with diethanolamine and ethanolamine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.