CAS 916971-31-8

Methyl (3R)-4-amino-3-hydroxybutanoate

Description:

Methyl (3R)-4-amino-3-hydroxybutanoate, also known as a derivative of the amino acid L-threonine, is characterized by its structural features that include an amino group (-NH2), a hydroxyl group (-OH), and a methyl ester functional group. This compound is typically a white to off-white crystalline solid, soluble in water due to the presence of polar functional groups. It exhibits properties typical of amino acids, such as the ability to participate in peptide bond formation and act as a building block for proteins. The specific stereochemistry at the 3R position indicates that it has a chiral center, which can influence its biological activity and interactions in biochemical pathways. Methyl (3R)-4-amino-3-hydroxybutanoate may be involved in various metabolic processes and could have potential applications in pharmaceuticals or biochemistry, particularly in studies related to amino acid metabolism or as a precursor in synthetic pathways. Its CAS number, 916971-31-8, provides a unique identifier for regulatory and research purposes.

Formula: C₅H₁₁NO₃

InChI: InChI=1S/C5H11NO3/c1-9-5(8)2-4(7)3-6/h4,7H,2-3,6H2,1H3/t4-/m1/s1

InChI key: InChIKey=QUTSKIWJUHDULC-SCSAIBSYSA-N

SMILES: C([C@H](CN)O)C(OC)=O

Synonyms:

• Butanoic acid, 4-amino-3-hydroxy-, methyl ester, (3R)-
• Methyl (3R)-4-amino-3-hydroxybutanoate