CAS 916979-09-4

3,5,6-trideuterio-4-(trideuteriomethyl)pyridin-2-amine

Description:

3,5,6-Trideuterio-4-(trideuteriomethyl)pyridin-2-amine is a deuterated derivative of pyridin-2-amine, which is a nitrogen-containing heterocyclic compound. The presence of deuterium, a stable isotope of hydrogen, in multiple positions of the molecule indicates that it is likely used in studies involving isotopic labeling, particularly in NMR spectroscopy or metabolic tracing. The compound features a pyridine ring, which is characterized by its aromaticity and basicity due to the nitrogen atom. The substitution of deuterium at the 3, 5, and 6 positions, along with a trideuteriomethyl group at the 4 position, alters the physical and chemical properties compared to its non-deuterated counterparts, such as changes in boiling and melting points, solubility, and reactivity. This compound may be of interest in pharmaceutical research, particularly in drug development and mechanistic studies, where isotopic effects can provide insights into reaction pathways and molecular interactions.

Formula: C₆H₂D₆N₂

InChI: InChI=1/C6H8N2/c1-5-2-3-8-6(7)4-5/h2-4H,1H3,(H2,7,8)/i1D3,2D,3D,4D

SMILES: C(c1c(c([nH]c(=N)c1[2H])[2H])[2H])([2H])([2H])[2H]