CAS 916979-10-7
:5-(Methyl-d3)-2-pyridin-3,4,6-d3-amine
Description:
5-(Methyl-d3)-2-pyridin-3,4,6-d3-amine is a deuterated derivative of a pyridine-based amine, characterized by the presence of deuterium isotopes in its molecular structure. This compound features a pyridine ring, which is a six-membered aromatic ring containing one nitrogen atom, and is substituted with an amine group and a methyl group that has been isotopically labeled with deuterium. The incorporation of deuterium enhances the compound's stability and can improve its detection in analytical techniques such as mass spectrometry and nuclear magnetic resonance (NMR) spectroscopy. The presence of multiple deuterium atoms can also influence the compound's physical and chemical properties, such as its solubility and reactivity. This compound may be utilized in various research applications, including studies in medicinal chemistry, where isotopic labeling can help trace metabolic pathways or elucidate mechanisms of action. As with any chemical substance, proper handling and safety protocols should be followed to mitigate any potential hazards associated with its use.
Formula:C6H2D6N2
InChI:InChI=1S/C6H8N2/c1-5-2-3-6(7)8-4-5/h2-4H,1H3,(H2,7,8)/i1D3,2D,3D,4D
InChI key:InChIKey=CMBSSVKZOPZBKW-RLTMCGQMSA-N
SMILES:C(C=1C(=C(C(N)=NC1[2H])[2H])[2H])([2H])([2H])[2H]
Synonyms:- 2-Amino-5-(methyl-d3)pyridine-3,4,6-d3
- 5-(Methyl-d3)-2-pyridin-3,4,6-d3-amine
- 2-Pyridin-3,4,6-d3-amine, 5-(methyl-d3)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
2-Amino-5-methylpyridine-d6
CAS:Controlled ProductApplications 2-Amino-5-methylpyridine-d6 is a reagent used in the preparation of deuterium-labeled nitrogen heterocycles using neutral D2O with heterogeneous Pd/C.
References Esaki, H., et al.: Tetrahedron, 62,10954(2006)Formula:C6D6H2N2Color and Shape:NeatMolecular weight:114.178
