CymitQuimica logo

CAS 916982-10-0

:

3-Isobutyl glutarimide

Description:
3-Isobutyl glutarimide is a chemical compound characterized by its imide functional group, which is derived from glutaric acid. It features a five-membered cyclic structure with a branched isobutyl group attached to the nitrogen atom of the imide. This compound is typically a white to off-white solid at room temperature and is soluble in organic solvents. Its molecular structure contributes to its potential applications in pharmaceuticals and agrochemicals, where it may serve as an intermediate or active ingredient. The presence of the isobutyl group can influence its physical and chemical properties, such as boiling point, melting point, and reactivity. Additionally, 3-Isobutyl glutarimide may exhibit specific biological activities, making it of interest in medicinal chemistry. As with many chemical substances, safety data sheets should be consulted for handling and toxicity information, as the compound may pose certain hazards. Overall, 3-Isobutyl glutarimide represents a unique structure within the imide class, with potential utility in various chemical applications.
Formula:C9H15NO2
InChI:InChI=1S/C9H15NO2/c1-6(2)3-7-4-8(11)10-9(12)5-7/h6-7H,3-5H2,1-2H3,(H,10,11,12)
InChI key:FNAQPQLVCOZGRH-UHFFFAOYSA-N
SMILES:CC(C)CC1CC(=O)NC(=O)C1
Synonyms:
  • 3-Isobutylglutarimid
  • 3-Isobutylglutarimide
Found 9 products.