
CAS 916982-10-0
:3-Isobutyl glutarimide
Description:
3-Isobutyl glutarimide is a chemical compound characterized by its imide functional group, which is derived from glutaric acid. It features a five-membered cyclic structure with a branched isobutyl group attached to the nitrogen atom of the imide. This compound is typically a white to off-white solid at room temperature and is soluble in organic solvents. Its molecular structure contributes to its potential applications in pharmaceuticals and agrochemicals, where it may serve as an intermediate or active ingredient. The presence of the isobutyl group can influence its physical and chemical properties, such as boiling point, melting point, and reactivity. Additionally, 3-Isobutyl glutarimide may exhibit specific biological activities, making it of interest in medicinal chemistry. As with many chemical substances, safety data sheets should be consulted for handling and toxicity information, as the compound may pose certain hazards. Overall, 3-Isobutyl glutarimide represents a unique structure within the imide class, with potential utility in various chemical applications.
Formula:C9H15NO2
InChI:InChI=1S/C9H15NO2/c1-6(2)3-7-4-8(11)10-9(12)5-7/h6-7H,3-5H2,1-2H3,(H,10,11,12)
InChI key:FNAQPQLVCOZGRH-UHFFFAOYSA-N
SMILES:CC(C)CC1CC(=O)NC(=O)C1
Synonyms:- 3-Isobutylglutarimid
- 3-Isobutylglutarimide
Filter by
Purity percentage
0
100
|
0
|
50
|
90
|
95
|
100
Found 9 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
4-(2-Methylpropyl)-2,6-piperidinedione
CAS:Formula:C9H15NO2Purity:98%Color and Shape:SolidMolecular weight:169.2209Pregabalin Impurity 13
CAS:Formula:C9H15NO2Color and Shape:White To Off-White SolidMolecular weight:169.234-Isobutylpiperidine-2,6-Dione
CAS:4-Isobutylpiperidine-2,6-DioneFormula:C9H15NO2Purity:>98%Color and Shape:SolidMolecular weight:169.22094-(2-Methylpropyl)piperidine-2,6-dione (3-Isobutylglutarimide)
CAS:Controlled ProductFormula:C9H15NO2Color and Shape:NeatMolecular weight:169.223-Isobutylglutarimid
CAS:4-Isobutylpiperidine-2,6-dioneFormula:C9H15NO2Purity:98%Molecular weight:169.224-(2-Methylpropyl)piperidine-2,6-dione
CAS:Formula:C9H15NO2Color and Shape:NeatMolecular weight:169.22Pregabalin Impurity 13 (4-Isobutyl-2,6-piperidinedione)
CAS:Pregabalin Impurity 13 is a stereoselective, synthetic compound that has been shown to be an inhibitor of gamma-aminobutyric acid (GABA) receptors. It can be synthesized by reacting 4-isobutyl-2,6-piperidinedione with hydrochloric acid and xylene. Pregabalin Impurity 13 binds to the amino acid sequence of GABA receptors in such a way as to prevent them from opening. This prevents the binding of GABA molecules to the receptor and reduces the duration of inhibition of these receptors. Pregabalin Impurity 13 has been shown to have antimicrobial activity against faecalis, which is found in human intestines and can cause infection. The environmental pollution caused by this impurity is due to its xylene content.
Formula:C9H15NO2Purity:Min. 95%Molecular weight:169.22 g/mol








