CAS 917-13-5
:(3S,6R,9S,12R,15S,18R)-4,10,16-trimethyl-3,6,9,12,15,18-hexa(propan-2-yl)-1,7,13-trioxa-4,10,16-triazacyclooctadecane-2,5,8,11,14,17-hexone
Description:
The chemical substance with the name "(3S,6R,9S,12R,15S,18R)-4,10,16-trimethyl-3,6,9,12,15,18-hexa(propan-2-yl)-1,7,13-trioxa-4,10,16-triazacyclooctadecane-2,5,8,11,14,17-hexone" and CAS number "917-13-5" is a complex organic compound characterized by its intricate structure, which includes multiple chiral centers and functional groups. This compound features a triazacyclooctadecane backbone, indicating the presence of nitrogen atoms within a cyclic structure, and is further modified with several alkyl groups, specifically propan-2-yl (isopropyl) groups, contributing to its steric bulk and hydrophobic characteristics. The presence of multiple oxo (keto) groups suggests potential reactivity and interactions with other chemical species. Its stereochemistry, denoted by the specific configuration at various carbon centers, plays a crucial role in determining its biological activity and interaction with other molecules. Such compounds may exhibit unique properties, including solubility, stability, and potential applications in fields like pharmaceuticals or materials science, depending on their specific structural features and functional groups.
Formula:C33H57N3O9
InChI:InChI=1/C33H57N3O9/c1-16(2)22-31(40)43-26(20(9)10)29(38)35(14)24(18(5)6)33(42)45-27(21(11)12)30(39)36(15)23(17(3)4)32(41)44-25(19(7)8)28(37)34(22)13/h16-27H,1-15H3/t22-,23-,24-,25+,26+,27+/m0/s1
Synonyms:- (3S,6R,9S,12R,15S,18R)-3,6,9,12,15,18-Hexaisopropyl-4,10,16-trimethyl-1,7,13-trioxa-4,10,16-triazacyclooctadecane-2,5,8,11,14,17-hexone
- 1,7,13-Trioxa-4,10,16-triazacyclooctadecane-2,5,8,11,14,17-hexone, 4,10,16-trimethyl-3,6,9,12,15,18-hexakis(1-methylethyl)-, (3S,6R,9S,12R,15S,18R)-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
Enniatin B
CAS:<p>Enniatin B</p>Formula:C33H57N3O9Purity:By hplc: 99.10% (Typical Value in Batch COA)Color and Shape: white powderMolecular weight:639.82g/molEnniatin B
CAS:<p>Enniatins B decreases the activation of ERK (p44/p42).</p>Formula:C33H57N3O9Purity:98%Color and Shape:SolidMolecular weight:639.831Enniatin B
CAS:<p>Enniatin B is a cyclic hexadepsipeptide, which is a secondary metabolite produced by Fusarium species. Its structure enables it to function as an ionophore, facilitating the disruption of ion gradients across cellular membranes by forming complexes with metal cations. This ionophoric activity leads to its primary mode of action—altering cellular homeostasis and affecting various ion-dependent processes.</p>Purity:Min. 95%




