
CAS 917-20-4
:Phosphonium, 1,1′-(1,10-decanediyl)bis[1,1,1-triphenyl-, bromide (1:2)
Description:
Phosphonium, 1,1′-(1,10-decanediyl)bis[1,1,1-triphenyl-, bromide (1:2), commonly referred to as a phosphonium salt, is characterized by its quaternary ammonium structure, where a phosphorus atom is bonded to four organic groups, in this case, two triphenyl groups and a long aliphatic chain. This compound typically exhibits properties associated with ionic compounds, such as high melting points and solubility in polar solvents. The presence of the bromide ions contributes to its ionic character, while the triphenyl groups provide significant steric hindrance and hydrophobic characteristics. The long decanediyl chain enhances the lipophilicity of the molecule, making it suitable for applications in organic synthesis and as a phase transfer catalyst. Additionally, phosphonium salts are known for their stability and can serve as intermediates in various chemical reactions, including those involving nucleophilic substitutions. Overall, this compound exemplifies the unique properties of phosphonium salts, combining both hydrophobic and ionic characteristics, which can be leveraged in diverse chemical applications.
Formula:C46H50P2·2Br
InChI:InChI=1S/C46H50P2.2BrH/c1(3-5-25-39-47(41-27-13-7-14-28-41,42-29-15-8-16-30-42)43-31-17-9-18-32-43)2-4-6-26-40-48(44-33-19-10-20-34-44,45-35-21-11-22-36-45)46-37-23-12-24-38-46;;/h7-24,27-38H,1-6,25-26,39-40H2;2*1H/q+2;;/p-2
InChI key:InChIKey=KQZABTMTNIFHCJ-UHFFFAOYSA-L
SMILES:[P+](CCCCCCCCCC[P+](C1=CC=CC=C1)(C2=CC=CC=C2)C3=CC=CC=C3)(C4=CC=CC=C4)(C5=CC=CC=C5)C6=CC=CC=C6.[Br-]
Synonyms:- Phosphonium, decamethylenebis[triphenyl-, dibromide
- Decaphosphenonium bromide
- Phosphonium, 1,1′-(1,10-decanediyl)bis[1,1,1-triphenyl-, bromide (1:2)
- Decamethylenebis[triphenylphosphonium bromide]
- Phosphonium, 1,10-decanediylbis[triphenyl-, dibromide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.