CAS 917-23-7: Tetraphenylporphyrin
Description:Tetraphenylporphyrin (TPP) is a synthetic porphyrin compound characterized by its large, planar structure composed of four phenyl groups attached to a porphyrin core. It is typically a deep purple or violet solid, known for its strong absorption in the visible region of the electromagnetic spectrum, making it useful in various applications, including photodynamic therapy and as a dye. TPP is a highly conjugated system, which contributes to its stability and unique electronic properties. It exhibits a high degree of lipophilicity due to the phenyl substituents, allowing it to interact effectively with biological membranes. Additionally, TPP can coordinate with metal ions, forming metalloporphyrins, which are important in biological systems, such as hemoglobin and chlorophyll. Its ability to act as a photosensitizer and its role in catalysis further enhance its significance in both research and industrial applications. Overall, tetraphenylporphyrin is a versatile compound with notable optical and chemical properties.
Formula:C44H30N4
InChI:InChI=1S/C44H30N4/c1-5-13-29(14-6-1)41-33-21-23-35(45-33)42(30-15-7-2-8-16-30)37-25-27-39(47-37)44(32-19-11-4-12-20-32)40-28-26-38(48-40)43(31-17-9-3-10-18-31)36-24-22-34(41)46-36/h1-28,45,48H/b41-33-,41-34?,42-35-,42-37?,43-36-,43-38?,44-39-,44-40?
InChI key:InChIKey=YNHJECZULSZAQK-VQHGFYMWSA-N
SMILES:N1=C2C=CC1=C(C=3C=CC=CC3)C4=CC=C(N4)C(=C5N=C(C=C5)C(C=6C=CC=CC6)=C7C=CC(N7)=C2C=8C=CC=CC8)C=9C=CC=CC9
- Synonyms:
- 5,10,15,20-Tetraphenyl-21H,23H-porphin
- 5,10,15,20-Tetraphenyl-21H,23H-porphine
- 5,10,15,20-Tetraphenyl-21H,23H-porphrin
- 5,10,15,20-Tetraphenyl-21H,23H-porphyrin
- 5,10,15,20-Tetraphenyl-22H,24H-prophyrin
- 5,10,15,20-Tetraphenylporphine
- 5,10,15,20-Tetraphenylporphyrin
- 5,10,15,20-tetrafenil-21H,23H-porfina
- A 5012
- Nsc 18506
- See more synonyms
- Nsc 640184
- Porphine, 5,10,15,20-tetraphenyl-
- Porphine, α,β,γ,δ-tetraphenyl-
- TPP
- TPP (chelating agent)
- Tetraphenylporphine
- Tetraphenylporphyrin
- meso-Tetraphenylporphine
- meso-Tetraphenylporphyrin
- α,β,γ,δ-Tetraphenylporphine
- 21H,23H-Porphine, 5,10,15,20-tetraphenyl-