
CAS 917-90-8
:(OC-6-21)-(1-Bromoethenyl)pentafluorosulfur
Description:
(OC-6-21)-(1-Bromoethenyl)pentafluorosulfur, with the CAS number 917-90-8, is a specialized chemical compound known for its unique structure and properties. It features a pentafluorosulfur moiety, which contributes to its high reactivity and potential applications in various fields, including materials science and organic synthesis. The presence of the bromoethenyl group enhances its reactivity, making it useful in nucleophilic substitution reactions and as an intermediate in the synthesis of more complex fluorinated compounds. This compound is typically characterized by its low boiling point and high volatility, which can pose handling challenges. Additionally, the fluorinated nature of the molecule imparts significant thermal and chemical stability, making it resistant to degradation under harsh conditions. Safety precautions are essential when working with this compound due to its potential toxicity and environmental impact. Overall, (OC-6-21)-(1-Bromoethenyl)pentafluorosulfur is a valuable compound in the realm of fluorinated chemicals, with applications that leverage its unique chemical properties.
Formula:C2H2BrF5S
InChI:InChI=1S/C2H2BrF5S/c1-2(3)9(4,5,6,7)8/h1H2
InChI key:InChIKey=PBLDXNCXFVDVCA-UHFFFAOYSA-N
SMILES:S(C(Br)=C)(F)(F)(F)(F)F
Synonyms:- (1-Bromoethenyl)pentafluoro-λ6-sulfane
- (1-Bromoethenyl)sulfur pentafluoride
- Sulfur, (1-bromovinyl)pentafluoro-
- (OC-6-21)-(1-Bromoethenyl)pentafluorosulfur
- Sulfur, (1-bromoethenyl)pentafluoro-, (OC-6-21)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
(1-Bromoethenyl)sulfur pentafluoride
CAS:(1-Bromoethenyl)sulfur pentafluoride
Molecular weight:232.9983g/mol

