CAS 91713-52-9
:(2-Aminophenyl)(3,4-dichlorophenyl)methanone
Description:
(2-Aminophenyl)(3,4-dichlorophenyl)methanone, with the CAS number 91713-52-9, is an organic compound characterized by its structure, which includes an amine group and a ketone functional group. This compound features a phenyl ring substituted with both an amino group at the 2-position and a dichlorophenyl group at the 3,4-positions. The presence of the amino group suggests potential for hydrogen bonding and reactivity in various chemical reactions, while the dichlorophenyl moiety may impart unique electronic properties and influence the compound's overall stability and reactivity. Typically, compounds of this nature can exhibit biological activity, making them of interest in medicinal chemistry and drug development. Additionally, the presence of chlorine atoms can enhance lipophilicity and affect the compound's solubility in organic solvents. Overall, the characteristics of this compound make it a subject of interest for further research in both synthetic and applied chemistry contexts.
Formula:C13H9Cl2NO
InChI:InChI=1S/C13H9Cl2NO/c14-10-6-5-8(7-11(10)15)13(17)9-3-1-2-4-12(9)16/h1-7H,16H2
InChI key:InChIKey=PQKIRIIJZKBFIG-UHFFFAOYSA-N
SMILES:C(=O)(C1=CC(Cl)=C(Cl)C=C1)C2=C(N)C=CC=C2
Synonyms:- (2-Aminophenyl)(3,4-dichlorophenyl)methanone
- Methanone, (2-aminophenyl)(3,4-dichlorophenyl)-
- 2-(3,4-Dichlorobenzoyl)aniline
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.