CymitQuimica logo

CAS 91713-54-1

:

(2-Amino-5-methoxyphenyl)(4-chlorophenyl)methanone

Description:
(2-Amino-5-methoxyphenyl)(4-chlorophenyl)methanone, with the CAS number 91713-54-1, is an organic compound characterized by its complex structure, which includes an amine group, a methoxy group, and a ketone functional group. This compound features a phenyl ring substituted with a chlorine atom and another phenyl ring that contains an amino group and a methoxy group. The presence of the amino group suggests potential basic properties, while the methoxy group can influence the compound's reactivity and solubility. The ketone functionality contributes to its potential as a reactive intermediate in various chemical reactions. This compound may exhibit biological activity, making it of interest in pharmaceutical research. Its molecular structure allows for various interactions, including hydrogen bonding and π-π stacking, which can affect its physical properties such as melting point, boiling point, and solubility in different solvents. Overall, this compound's unique combination of functional groups makes it a subject of interest in both synthetic and medicinal chemistry.
Formula:C14H12ClNO2
InChI:InChI=1S/C14H12ClNO2/c1-18-11-6-7-13(16)12(8-11)14(17)9-2-4-10(15)5-3-9/h2-8H,16H2,1H3
InChI key:InChIKey=MIQUXYBYLZSOIJ-UHFFFAOYSA-N
SMILES:C(=O)(C1=CC(OC)=CC=C1N)C2=CC=C(Cl)C=C2
Synonyms:
  • (2-Amino-5-methoxyphenyl)(4-chlorophenyl)methanone
  • [2-Amino-5-(methyloxy)phenyl](4-chlorophenyl)methanone
  • 2-(4-Chlorobenzoyl)-4-methoxyaniline
  • Methanone, (2-amino-5-methoxyphenyl)(4-chlorophenyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.