CAS 91717-85-0

1,2,10-Decanetriol

Description:

1,2,10-Decanetriol is a chemical compound characterized by its structure as a triol, meaning it contains three hydroxyl (-OH) functional groups. It is a straight-chain aliphatic alcohol with a total of ten carbon atoms, which contributes to its hydrophobic characteristics while still allowing for some solubility in water due to the presence of hydroxyl groups. This compound is typically a colorless, viscous liquid at room temperature and has a relatively high boiling point compared to simpler alcohols due to its larger molecular size and the ability to form hydrogen bonds. 1,2,10-Decanetriol is often used in various applications, including as a surfactant, emulsifier, or in the formulation of personal care products. Its unique structure allows it to exhibit both hydrophilic and hydrophobic properties, making it versatile in different chemical environments. Additionally, it may have applications in the synthesis of other chemical compounds or as a potential additive in industrial processes. Safety data should be reviewed for handling and usage, as with any chemical substance.

Formula: C₁₀H₂₂O₃

InChI: InChI=1/C10H22O3/c11-8-6-4-2-1-3-5-7-10(13)9-12/h10-13H,1-9H2

SMILES: C(CCCCO)CCCC(CO)O

Synonyms:

• Decane-1,2,10-Triol

1,2,10-Decanetriol

CAS: 91717-85-0

Formula: C₁₀H₂₂O₃

Purity: >97.0%(GC)

Color and Shape: White to Almost white powder to crystal

Molecular weight: 190.28

Ref: 3B-D2721

1,2,10-Decanetriol

CAS: 91717-85-0

Formula: C₁₀H₂₂O₃

Purity: 97%

Color and Shape: Solid

Molecular weight: 190.2799

Ref: IN-DA003D9G

1,2,10-Decanetriol

Controlled Product

CAS: 91717-85-0

Applications 1,2,10-Decanetriol (cas# 91717-85-0) is a compound useful in organic synthesis.

Formula: C₁₀H₂₂O₃

Color and Shape: Neat

Molecular weight: 190.28

Ref: TR-D212500

Decane-1,2,10-triol

CAS: 91717-85-0

Purity: 97.0%

Molecular weight: 190.2830048

Ref: 10-F728760