CAS 91718-20-6
:3-Iodo-4-methoxybiphenyl
Description:
3-Iodo-4-methoxybiphenyl, with the CAS number 91718-20-6, is an organic compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. The compound features an iodine atom at the 3-position and a methoxy group (-OCH3) at the 4-position of one of the phenyl rings. This substitution pattern influences its chemical reactivity and physical properties. Typically, compounds like 3-Iodo-4-methoxybiphenyl exhibit moderate solubility in organic solvents due to their hydrophobic nature, while being less soluble in water. The presence of the iodine atom can enhance the compound's reactivity in electrophilic aromatic substitution reactions, while the methoxy group can serve as an electron-donating group, affecting the electron density on the aromatic rings. Such compounds are often of interest in organic synthesis, materials science, and medicinal chemistry due to their potential applications in pharmaceuticals and as intermediates in the synthesis of more complex molecules.
Formula:C13H11IO
InChI:InChI=1/C13H11IO/c1-15-13-8-7-11(9-12(13)14)10-5-3-2-4-6-10/h2-9H,1H3
SMILES:COc1ccc(cc1I)c1ccccc1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
