CAS 91719-58-3
:[2-iodo-5-[(Z)-(2-methyl-5-oxo-oxazol-4-ylidene)methyl]phenyl] acetate
Description:
The chemical substance known as [2-iodo-5-[(Z)-(2-methyl-5-oxo-oxazol-4-ylidene)methyl]phenyl] acetate, with the CAS number 91719-58-3, is a complex organic compound characterized by its unique structural features. It contains an iodo substituent, which typically enhances its reactivity and potential applications in organic synthesis. The presence of the oxazole ring indicates that it may exhibit biological activity, as oxazole derivatives are often studied for their pharmacological properties. The acetate functional group suggests that the compound may have ester-like characteristics, influencing its solubility and reactivity. The Z configuration of the oxazolylidene moiety implies specific stereochemical properties that could affect its interactions in biological systems. Overall, this compound may be of interest in medicinal chemistry and materials science due to its potential reactivity and biological significance, although specific applications would depend on further research and characterization.
Formula:C13H10INO4
InChI:InChI=1/C13H10INO4/c1-7-15-11(13(17)18-7)5-9-3-4-10(14)12(6-9)19-8(2)16/h3-6H,1-2H3/b11-5-
SMILES:CC1=N/C(=C\c2ccc(c(c2)OC(=O)C)I)/C(=O)O1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
4-(4-Acetoxy-3-iodobenzal)-2-methyl-5-oxazolone
CAS:Controlled ProductApplications 4-(4-Acetoxy-3-iodobenzal)-2-methyl-5-oxazolone (cas# 91719-58-3) is a compound useful in organic synthesis.
Formula:C13H10INO4Color and Shape:NeatMolecular weight:371.13
