
CAS 91720-93-3
:2-(2-Bromophenoxy)cyclohexanone
Description:
2-(2-Bromophenoxy)cyclohexanone, with the CAS number 91720-93-3, is an organic compound characterized by its unique structure, which includes a cyclohexanone ring substituted with a 2-bromophenoxy group. This compound typically exhibits a white to off-white crystalline appearance. It is known for its potential applications in organic synthesis and as an intermediate in the production of various pharmaceuticals and agrochemicals. The presence of the bromine atom in the phenoxy group can influence its reactivity, making it a useful building block in chemical reactions, particularly in electrophilic aromatic substitution. Additionally, the cyclohexanone moiety contributes to its ketone functionality, which can participate in various chemical transformations, including condensation and reduction reactions. The compound's solubility and stability can vary depending on the solvent and environmental conditions. As with many organic compounds, safety precautions should be taken when handling it, as it may pose health risks if ingested or inhaled.
Formula:C12H13BrO2
InChI:InChI=1S/C12H13BrO2/c13-9-5-1-3-7-11(9)15-12-8-4-2-6-10(12)14/h1,3,5,7,12H,2,4,6,8H2
InChI key:InChIKey=ITXAUXOKNCIECF-UHFFFAOYSA-N
SMILES:O(C1=C(Br)C=CC=C1)C2C(=O)CCCC2
Synonyms:- 2-(2-Bromophenoxy)cyclohexan-1-one
- Cyclohexanone, 2-(2-bromophenoxy)-
- Cyclohexanone, 2-(o-bromophenoxy)-
- 2-(2-Bromophenoxy)cyclohexanone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.