CAS 917217-91-5

2-{[1-(3-methylphenyl)-1H-tetrazol-5-yl]sulfanyl}propanoic acid

Description:

2-{[1-(3-methylphenyl)-1H-tetrazol-5-yl]sulfanyl}propanoic acid, identified by its CAS number 917217-91-5, is a chemical compound characterized by its unique structure that includes a propanoic acid moiety linked to a tetrazole ring via a sulfanyl group. This compound features a 3-methylphenyl substituent on the tetrazole, which contributes to its potential biological activity and solubility properties. The presence of the tetrazole ring suggests possible applications in medicinal chemistry, as tetrazoles are known for their diverse pharmacological properties. The sulfanyl group may enhance the compound's reactivity and interaction with biological targets. In terms of physical properties, while specific values such as melting point or solubility are not provided, compounds of this nature typically exhibit moderate to high polarity due to the carboxylic acid functional group and the heteroatoms in the tetrazole. Overall, this compound's unique structural features may make it of interest in drug development and other chemical applications.

Formula: C₁₁H₁₂N₄O₂S

InChI: InChI=1/C11H12N4O2S/c1-7-4-3-5-9(6-7)15-11(12-13-14-15)18-8(2)10(16)17/h3-6,8H,1-2H3,(H,16,17)

SMILES: Cc1cccc(c1)n1c(nnn1)SC(C)C(=O)O

2-{[1-(3-methylphenyl)-1H-tetrazol-5-yl]thio}propanoic acid

CAS: 917217-91-5

Formula: C₁₁H₁₂N₄O₂S

Purity: 95.0%

Molecular weight: 264.3

Ref: 10-F316037