CAS 91724-74-2

6-Mercaptonorleucine

Description:

6-Mercaptonorleucine, identified by its CAS number 91724-74-2, is an amino acid derivative characterized by the presence of a thiol (-SH) group, which imparts unique chemical properties. This compound is a structural analog of leucine, featuring a mercapto group at the 6-position of the norleucine backbone. The presence of the thiol group enhances its reactivity, allowing it to participate in various biochemical processes, including redox reactions and the formation of disulfide bonds. 6-Mercaptonorleucine is of interest in biochemical research, particularly in studies related to protein synthesis and enzyme activity, as it may influence the folding and stability of proteins. Additionally, its potential applications in medicinal chemistry and as a biochemical probe make it a subject of ongoing research. The compound is typically handled with care due to the reactivity of the thiol group, which can lead to the formation of unwanted side products if not managed properly. Overall, 6-Mercaptonorleucine serves as a valuable tool in the exploration of amino acid functionalities and their biological implications.

Formula: C₆H₁₃NO₂S

InChI: InChI=1S/C6H13NO2S/c7-5(6(8)9)3-1-2-4-10/h5,10H,1-4,7H2,(H,8,9)

InChI key: InChIKey=HBMWPJLCTYKAGL-UHFFFAOYSA-N

SMILES: C(CCCCS)(C(O)=O)N

Synonyms:

• 2-Amino-6-sulfanylhexanoic acid
• 6-Mercaptonorleucine
• Norleucine, 6-mercapto-