CAS 917252-80-3
:6-(Methoxycarbonyl)-2-(4-methylphenyl)imidazo[1,2-a]pyridine-3-acetic acid
Description:
6-(Methoxycarbonyl)-2-(4-methylphenyl)imidazo[1,2-a]pyridine-3-acetic acid is a chemical compound characterized by its complex structure, which includes an imidazo[1,2-a]pyridine core, a methoxycarbonyl group, and a 4-methylphenyl substituent. This compound typically exhibits properties such as moderate solubility in organic solvents and potential bioactivity, making it of interest in pharmaceutical research. The presence of the carboxylic acid functional group suggests it may participate in acid-base reactions, while the methoxycarbonyl group can influence its reactivity and stability. The imidazo[1,2-a]pyridine framework is known for its role in various biological activities, including antimicrobial and anticancer properties. Additionally, the 4-methylphenyl group may enhance lipophilicity, affecting the compound's pharmacokinetics. Overall, this compound's unique structural features contribute to its potential applications in medicinal chemistry and drug development.
Formula:C18H16N2O4
InChI:InChI=1S/C18H16N2O4/c1-11-3-5-12(6-4-11)17-14(9-16(21)22)20-10-13(18(23)24-2)7-8-15(20)19-17/h3-8,10H,9H2,1-2H3,(H,21,22)
InChI key:InChIKey=OKWRTEAEZIXBEW-UHFFFAOYSA-N
SMILES:C(C(O)=O)C=1N2C(=NC1C3=CC=C(C)C=C3)C=CC(C(OC)=O)=C2
Synonyms:- 6-(Methoxycarbonyl)-2-(4-methylphenyl)imidazo[1,2-a]pyridine-3-acetic acid
- Imidazo[1,2-a]pyridine-3-acetic acid, 6-(methoxycarbonyl)-2-(4-methylphenyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.