CAS 917357-83-6
:benzyl 3-(methylamino)pyrrolidine-1-carboxylate
Description:
Benzyl 3-(methylamino)pyrrolidine-1-carboxylate is a chemical compound characterized by its unique structure, which includes a pyrrolidine ring, a carboxylate group, and a benzyl moiety. This compound typically exhibits properties associated with both amines and carboxylic acids, such as basicity and potential for hydrogen bonding. The presence of the methylamino group suggests that it may participate in various chemical reactions, including nucleophilic substitutions and acylation. Its benzyl group can enhance lipophilicity, potentially affecting its solubility in organic solvents and biological systems. The compound may also exhibit pharmacological activity, making it of interest in medicinal chemistry. Additionally, its molecular structure allows for stereochemical considerations, which can influence its biological interactions and efficacy. As with many organic compounds, the stability and reactivity can be influenced by environmental factors such as pH and temperature. Overall, benzyl 3-(methylamino)pyrrolidine-1-carboxylate is a versatile compound with potential applications in various fields, including pharmaceuticals and organic synthesis.
Formula:C13H18N2O2
InChI:InChI=1/C13H18N2O2/c1-14-12-7-8-15(9-12)13(16)17-10-11-5-3-2-4-6-11/h2-6,12,14H,7-10H2,1H3
SMILES:CNC1CCN(C1)C(=O)OCc1ccccc1
Synonyms:- Benzyl 3-(methylamino)pyrrolidine-1-carboxylate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.