CymitQuimica logo

CAS 917364-12-6

:

1-Isopropyl-1H-imidazole-4-carboxylic acid

Description:
1-Isopropyl-1H-imidazole-4-carboxylic acid is an organic compound characterized by its imidazole ring structure, which is a five-membered aromatic heterocycle containing two nitrogen atoms. This compound features a carboxylic acid functional group, contributing to its acidic properties. The isopropyl group attached to the imidazole ring enhances its hydrophobic characteristics, potentially influencing its solubility and reactivity in various solvents. The presence of the carboxylic acid group allows for potential interactions such as hydrogen bonding, which can affect its biological activity and interactions with other molecules. This compound may be of interest in pharmaceutical research due to its structural features, which could impart specific biological activities or serve as a building block in the synthesis of more complex molecules. Its CAS number, 917364-12-6, allows for precise identification in chemical databases and literature. Overall, 1-Isopropyl-1H-imidazole-4-carboxylic acid exhibits a unique combination of properties that may be leveraged in various chemical and biological applications.
Formula:C7H10N2O2
InChI:InChI=1/C7H10N2O2/c1-5(2)9-3-6(7(10)11)8-4-9/h3-5H,1-2H3,(H,10,11)
SMILES:CC(C)n1cc(C(=O)O)nc1
Synonyms:
  • 1-(propan-2-yl)-1H-imidazole-4-carboxylic acid
  • 1H-imidazole-4-carboxylic acid, 1-(1-methylethyl)-
  • 1-Isopropylimidazole-4-Carboxylic Acid
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.