CAS 917396-38-4

3-(Chloromethyl)-2-methoxy-6-(trifluoromethyl)pyridine

Description:

3-(Chloromethyl)-2-methoxy-6-(trifluoromethyl)pyridine is a heterocyclic organic compound characterized by its pyridine ring, which is a six-membered aromatic ring containing one nitrogen atom. This compound features a chloromethyl group (-CH2Cl) at the 3-position, a methoxy group (-OCH3) at the 2-position, and a trifluoromethyl group (-CF3) at the 6-position of the pyridine ring. The presence of the trifluoromethyl group imparts unique electronic properties, enhancing the compound's lipophilicity and potentially influencing its reactivity and biological activity. The methoxy group can act as an electron-donating substituent, while the chloromethyl group may serve as a reactive site for further chemical transformations. This compound is of interest in medicinal chemistry and material science due to its potential applications in drug development and as a building block for synthesizing more complex molecules. Its specific physical and chemical properties, such as solubility, melting point, and reactivity, would need to be determined experimentally or sourced from chemical databases.

Formula: C₈H₇ClF₃NO

InChI: InChI=1S/C8H7ClF3NO/c1-14-7-5(4-9)2-3-6(13-7)8(10,11)12/h2-3H,4H2,1H3

InChI key: InChIKey=KUBNMKJHVGZTRK-UHFFFAOYSA-N

SMILES: O(C)C1=C(CCl)C=CC(C(F)(F)F)=N1

Synonyms:

• Pyridine, 3-(chloromethyl)-2-methoxy-6-(trifluoromethyl)-
• 3-(Chloromethyl)-2-methoxy-6-(trifluoromethyl)pyridine