CAS 917396-39-5

2-Chloro-6-(trifluoromethyl)-3-pyridinemethanol

Description:

2-Chloro-6-(trifluoromethyl)-3-pyridinemethanol is a chemical compound characterized by its pyridine ring structure, which is a six-membered aromatic ring containing one nitrogen atom. The presence of a chloro group at the 2-position and a trifluoromethyl group at the 6-position significantly influences its chemical properties, including its reactivity and polarity. The hydroxymethyl group at the 3-position contributes to its potential as a functionalized compound in various chemical reactions. This compound is typically a solid at room temperature and is soluble in polar organic solvents. Its unique structure makes it of interest in medicinal chemistry and material science, where it may serve as a building block for the synthesis of more complex molecules. Additionally, the trifluoromethyl group is known to enhance biological activity and lipophilicity, making this compound a candidate for further research in drug development. Safety data should be reviewed before handling, as halogenated compounds can exhibit toxicity and environmental persistence.

Formula: C₇H₅ClF₃NO

InChI: InChI=1S/C7H5ClF3NO/c8-6-4(3-13)1-2-5(12-6)7(9,10)11/h1-2,13H,3H2

InChI key: InChIKey=WWVOQPNHXXAYKT-UHFFFAOYSA-N

SMILES: C(F)(F)(F)C=1N=C(Cl)C(CO)=CC1

Synonyms:

• [2-Chloro-6-(trifluoromethyl)pyridin-3-yl]methanol
• 2-Chloro-6-(trifluoromethyl)-3-pyridinemethanol
• 3-Pyridinemethanol, 2-chloro-6-(trifluoromethyl)-

(2-Chloro-6-(trifluoromethyl)pyridin-3-yl)methanol

CAS: 917396-39-5

Formula: C₇H₅ClF₃NO

Purity: 95%

Molecular weight: 211.5689

Ref: IN-DA00GRE9

(2-chloro-6-(trifluoromethyl)pyridin-3-yl)methanol

CAS: 917396-39-5

(2-chloro-6-(trifluoromethyl)pyridin-3-yl)methanol

Purity: 90%

Molecular weight: 211.57g/mol

Ref: 54-PC907843

[2-Chloro-6-(trifluoromethyl)pyridin-3-yl]methanol

CAS: 917396-39-5

Formula: C₇H₅ClF₃NO

Purity: ≥95%

Molecular weight: 211.57

Ref: 10-F067713