CymitQuimica logo

CAS 917397-90-1

:

α-Methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzeneacetamide

Description:
α-Methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzeneacetamide, with the CAS number 917397-90-1, is a chemical compound that features a complex structure incorporating both an aromatic ring and a boron-containing moiety. This compound is characterized by its unique dioxaborolane group, which contributes to its reactivity and potential applications in organic synthesis, particularly in the formation of carbon-boron bonds. The presence of the acetamide functional group suggests that it may exhibit properties typical of amides, such as hydrogen bonding capabilities and potential solubility in polar solvents. The α-methyl substitution on the benzene ring can influence its steric and electronic properties, potentially enhancing its reactivity in various chemical reactions. Overall, this compound may be of interest in medicinal chemistry and materials science due to its structural features and the role of boron in enhancing the properties of organic molecules.
Formula:C15H22BNO3
InChI:InChI=1S/C15H22BNO3/c1-10(13(17)18)11-6-8-12(9-7-11)16-19-14(2,3)15(4,5)20-16/h6-10H,1-5H3,(H2,17,18)
InChI key:InChIKey=NDGZLRSFKACQBP-UHFFFAOYSA-N
SMILES:CC1(C)OB(OC1(C)C)C2=CC=C(C(C(N)=O)C)C=C2
Synonyms:
  • α-Methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzeneacetamide
  • Benzeneacetamide, α-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.