CAS 91742-10-8
:N-[2-[(Aminoiminomethyl)amino]ethyl]-5-isoquinolinesulfonamide
Description:
N-[2-[(Aminoiminomethyl)amino]ethyl]-5-isoquinolinesulfonamide, with CAS number 91742-10-8, is a chemical compound characterized by its complex structure, which includes an isoquinoline moiety and a sulfonamide functional group. This compound typically exhibits properties associated with sulfonamides, such as potential antibacterial activity, due to the presence of the sulfonamide group, which can interfere with bacterial folic acid synthesis. The aminoiminomethyl and aminoethyl substituents suggest that it may also have roles in biological systems, possibly as a ligand or in enzyme inhibition. The isoquinoline structure contributes to its potential pharmacological properties, as isoquinolines are known for their diverse biological activities, including antitumor and anti-inflammatory effects. The compound's solubility, stability, and reactivity would depend on its specific functional groups and the surrounding environment. Overall, this substance may be of interest in medicinal chemistry and drug development, particularly in the context of targeting specific biological pathways or diseases.
Formula:C12H15N5O2S
InChI:InChI=1S/C12H15N5O2S/c13-12(14)16-6-7-17-20(18,19)11-3-1-2-9-8-15-5-4-10(9)11/h1-5,8,17H,6-7H2,(H4,13,14,16)
InChI key:InChIKey=MZNDNBFMSVMUCX-UHFFFAOYSA-N
SMILES:S(NCCNC(=N)N)(=O)(=O)C=1C2=C(C=CC1)C=NC=C2
Synonyms:- 5-Isoquinolinesulfonamide, N-[2-[(aminoiminomethyl)amino]ethyl]-
- Ha-1004
- Ht 1004
- N-[2-[(Aminoiminomethyl)amino]ethyl]-5-isoquinolinesulfonamide
- N-{2-[(diaminomethylidene)amino]ethyl}isoquinoline-5-sulfonamide


