CAS 917482-45-2

(1S)-1-[3-(dimethylnitroryl)propyl]-1-(4-fluorophenyl)-1,3-dihydro-2-benzofuran-5-carbonitrile

Description:

The chemical substance known as (1S)-1-[3-(dimethylnitroyl)propyl]-1-(4-fluorophenyl)-1,3-dihydro-2-benzofuran-5-carbonitrile, with the CAS number 917482-45-2, is a complex organic compound characterized by its unique structural features. It contains a benzofuran moiety, which contributes to its potential biological activity, and a carbonitrile functional group that may influence its reactivity and solubility. The presence of a fluorophenyl group suggests potential interactions with biological targets, while the dimethylnitroyl substituent may impart specific electronic properties. This compound is likely to exhibit specific pharmacological effects, making it of interest in medicinal chemistry. Its stereochemistry, indicated by the (1S) configuration, suggests that it may have distinct chiral properties that could affect its biological interactions. Overall, the compound's intricate structure and functional groups suggest potential applications in drug development or as a research chemical, although specific biological activities and safety profiles would require further investigation.

Formula: C₂₀H₂₁FN₂O₂

InChI: InChI=1/C20H21FN2O2/c1-23(2,24)11-3-10-20(17-5-7-18(21)8-6-17)19-9-4-15(13-22)12-16(19)14-25-20/h4-9,12H,3,10-11,14H2,1-2H3/t20-/m0/s1

SMILES: CN(=O)(C)CCC[C@]1(c2ccc(cc2)F)c2ccc(cc2CO1)C#N

(S)-Citalopram N-Oxide (Escitalopram N-Oxide)

CAS: 917482-45-2

Formula: C₂₀H₂₁FN₂O₂

Color and Shape: Na Sticky Oil

Molecular weight: 340.40

Ref: 4Z-C-0913

Escitalopram N-Oxide

CAS: 917482-45-2

Formula: C₂₀H₂₁FN₂O₂

Color and Shape: Neat

Molecular weight: 340.39

Ref: 86-MM1162.05

(S)-Citalopram N-Oxide

Controlled Product

CAS: 917482-45-2

Stability Hygroscopic
Applications (S)-Citalopram N-Oxide (cas# 917482-45-2) is a compound useful in organic synthesis.

Formula: C₂₀H₂₁FN₂O₂

Color and Shape: Neat

Molecular weight: 340.39

Ref: TR-C505045

Escitalopram N-Oxide

CAS: 917482-45-2

Formula: C₂₀H₂₁FN₂O₂

Molecular weight: 340.4

Ref: ST-EA-CP-E13028