CymitQuimica logo

CAS 91749-26-7

:

5-iodo-4-methyl-pyrimidine

Description:
5-Iodo-4-methyl-pyrimidine is a heterocyclic organic compound characterized by a pyrimidine ring, which is a six-membered aromatic ring containing two nitrogen atoms at positions 1 and 3. The presence of an iodine atom at the 5-position and a methyl group at the 4-position distinguishes this compound. It typically appears as a colorless to pale yellow solid and is soluble in organic solvents. The compound is of interest in medicinal chemistry and organic synthesis due to its potential applications in pharmaceuticals and agrochemicals. Its structure allows for various chemical reactions, including nucleophilic substitutions and coupling reactions, making it a versatile intermediate in the synthesis of more complex molecules. Additionally, the iodine substituent can enhance the compound's reactivity and influence its biological activity. Safety data should be consulted, as halogenated compounds can exhibit varying levels of toxicity and environmental impact. Overall, 5-iodo-4-methyl-pyrimidine is a valuable compound in chemical research and development.
Formula:C5H5IN2
InChI:InChI=1/C5H5IN2/c1-4-5(6)2-7-3-8-4/h2-3H,1H3
SMILES:Cc1c(cncn1)I
Synonyms:
  • 5-Iodo-4-methylpyrimidine
  • Pyrimidine, 5-Iodo-4-Methyl-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.