CymitQuimica logo

CAS 917505-34-1

:

3-(2-Phenylethyl)-3-pyrrolidinol

Description:
3-(2-Phenylethyl)-3-pyrrolidinol, identified by its CAS number 917505-34-1, is a chemical compound characterized by its unique structure that includes a pyrrolidine ring substituted with a phenylethyl group. This compound typically exhibits properties associated with both amines and alcohols due to the presence of the hydroxyl (-OH) group and the nitrogen atom in the pyrrolidine ring. It is likely to be a solid or liquid at room temperature, depending on its specific molecular interactions and purity. The presence of the phenylethyl group suggests potential for aromatic interactions, which may influence its solubility and reactivity. Additionally, compounds like this can exhibit biological activity, making them of interest in pharmaceutical research. The compound's stability, reactivity, and potential applications would depend on its specific functional groups and the overall molecular structure. As with many organic compounds, safety data sheets should be consulted for handling and storage guidelines, as well as potential hazards associated with its use.
Formula:C12H17NO
InChI:InChI=1S/C12H17NO/c14-12(8-9-13-10-12)7-6-11-4-2-1-3-5-11/h1-5,13-14H,6-10H2
InChI key:InChIKey=DFHDOMYHCDJPMU-UHFFFAOYSA-N
SMILES:C(CC1=CC=CC=C1)C2(O)CCNC2
Synonyms:
  • 3-(2-Phenylethyl)-3-pyrrolidinol
  • 3-Pyrrolidinol, 3-(2-phenylethyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.