CAS 91753-30-9

3,4-Dihydroxybenzoic acid monopotassium salt

Description:

3,4-Dihydroxybenzoic acid monopotassium salt, with the CAS number 91753-30-9, is a potassium salt derived from 3,4-dihydroxybenzoic acid, which is a phenolic compound. This substance typically appears as a white to off-white crystalline powder and is soluble in water due to the presence of the potassium ion, which enhances its solubility compared to its acid form. It exhibits antioxidant properties, making it of interest in various applications, including food preservation and potential health benefits. The compound is characterized by the presence of two hydroxyl (-OH) groups on the benzene ring, which contribute to its reactivity and ability to form hydrogen bonds. Additionally, it may play a role in metabolic processes and has been studied for its potential therapeutic effects. As with many phenolic compounds, it may also exhibit antimicrobial activity. Safety data should be consulted for handling and usage, as with any chemical substance.

Formula: C₇H₅KO₄

InChI: InChI=1/C7H6O4.K/c8-5-2-1-4(7(10)11)3-6(5)9;/h1-3,8-9H,(H,10,11);/q;+1/p-1

SMILES: c1cc(c(cc1C(=O)O)O)O.K

Potassium 3,4-dihydroxybenzoate

CAS: 91753-30-9

Formula: C₇H₅KO₄

Purity: 98%

Color and Shape: Solid

Molecular weight: 192.2105

Ref: IN-DA006DQ4