CAS 917560-91-9

3-(4-Fluorophenyl)-2,5-dihydro-1H-pyrrole

Description:

3-(4-Fluorophenyl)-2,5-dihydro-1H-pyrrole is an organic compound characterized by its pyrrole ring structure, which is a five-membered aromatic ring containing nitrogen. The presence of a 4-fluorophenyl group indicates that a fluorine atom is substituted on the phenyl ring at the para position, influencing the compound's electronic properties and reactivity. This compound typically exhibits moderate solubility in organic solvents due to its relatively non-polar nature, while its nitrogen-containing heterocycle can participate in hydrogen bonding. The dihydropyrrole structure suggests that it may exist in a partially saturated form, which can affect its stability and reactivity. Such compounds are often of interest in medicinal chemistry for their potential biological activities, including anti-inflammatory and anticancer properties. The specific characteristics, such as melting point, boiling point, and spectral data, would require experimental determination or reference to specialized databases. Overall, 3-(4-Fluorophenyl)-2,5-dihydro-1H-pyrrole represents a versatile scaffold for further chemical modifications and applications in drug development.

Formula: C₁₀H₁₀FN

InChI: InChI=1S/C10H10FN/c11-10-3-1-8(2-4-10)9-5-6-12-7-9/h1-5,12H,6-7H2

InChI key: InChIKey=SMTXNEWLAXAGNV-UHFFFAOYSA-N

SMILES: FC1=CC=C(C=C1)C2=CCNC2

Synonyms:

• 3-(4-Fluorophenyl)-2,5-dihydro-1H-pyrrole
• 1H-Pyrrole, 3-(4-fluorophenyl)-2,5-dihydro-