CAS 917562-07-3
:4-(3-aminopropyl)piperazin-2-one
Description:
4-(3-Aminopropyl)piperazin-2-one, identified by its CAS number 917562-07-3, is a chemical compound characterized by its piperazine core, which is a six-membered ring containing two nitrogen atoms. This compound features an amino group attached to a propyl chain, which contributes to its potential biological activity. It is typically a white to off-white solid and is soluble in polar solvents, reflecting its amine functional groups. The presence of the piperazine ring suggests that it may exhibit properties relevant to pharmacology, particularly in the development of pharmaceuticals targeting the central nervous system or other biological pathways. Its structure allows for various interactions with biological targets, making it a subject of interest in medicinal chemistry. Additionally, the compound may undergo typical reactions associated with amines and piperazines, such as alkylation or acylation, which can be utilized in further synthetic applications. Safety and handling precautions should be observed, as with any chemical substance, due to potential toxicity or reactivity.
Formula:C7H15N3O
InChI:InChI=1/C7H15N3O/c8-2-1-4-10-5-3-9-7(11)6-10/h1-6,8H2,(H,9,11)
SMILES:C(CN)CN1CCN=C(C1)O
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.