
CAS 917562-12-0
:6-Methoxy-3-[[[2-(2-methylphenyl)ethyl]amino]methyl]-2(1H)-quinolinone
Description:
6-Methoxy-3-[[[2-(2-methylphenyl)ethyl]amino]methyl]-2(1H)-quinolinone, identified by its CAS number 917562-12-0, is a synthetic organic compound characterized by its quinolinone core structure, which is a bicyclic compound containing a quinoline moiety fused with a carbonyl group. This compound features a methoxy group at the 6-position and an aminoethyl side chain that includes a 2-methylphenyl substituent, contributing to its potential biological activity. The presence of the methoxy group can influence the compound's solubility and reactivity, while the aminoethyl side chain may enhance its interaction with biological targets, making it of interest in medicinal chemistry. The compound's molecular structure suggests potential applications in pharmacology, particularly in the development of therapeutic agents. Its properties, such as solubility, stability, and reactivity, would depend on the specific functional groups and their arrangement, which can affect its behavior in biological systems and its overall efficacy as a drug candidate.
Formula:C20H22N2O2
InChI:InChI=1S/C20H22N2O2/c1-14-5-3-4-6-15(14)9-10-21-13-17-11-16-12-18(24-2)7-8-19(16)22-20(17)23/h3-8,11-12,21H,9-10,13H2,1-2H3,(H,22,23)
InChI key:InChIKey=ANQBOIPAMSQAOV-UHFFFAOYSA-N
SMILES:C(NCCC1=C(C)C=CC=C1)C2=CC=3C(NC2=O)=CC=C(OC)C3
Synonyms:- 6-Methoxy-3-[[[2-(2-methylphenyl)ethyl]amino]methyl]-2(1H)-quinolinone
- 2(1H)-Quinolinone, 6-methoxy-3-[[[2-(2-methylphenyl)ethyl]amino]methyl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.