
CAS 917562-34-6
:2-Chloro-N-(4,5-dihydronaphtho[1,2-d]thiazol-2-yl)acetamide
Description:
2-Chloro-N-(4,5-dihydronaphtho[1,2-d]thiazol-2-yl)acetamide is a chemical compound characterized by its unique structural features, which include a chloro substituent and a thiazole moiety fused with a naphthalene derivative. This compound typically exhibits moderate to high lipophilicity due to its polycyclic structure, which can influence its solubility and bioavailability. The presence of the chloro group may impart specific reactivity and stability characteristics, making it a potential candidate for various chemical reactions. Additionally, the thiazole ring contributes to its biological activity, as thiazoles are often found in pharmacologically active compounds. The compound may exhibit specific interactions with biological targets, which could be of interest in medicinal chemistry. Its molecular weight, melting point, and other physical properties would be determined through experimental methods, and it may be subject to regulatory considerations depending on its intended use. Overall, 2-Chloro-N-(4,5-dihydronaphtho[1,2-d]thiazol-2-yl)acetamide represents a complex organic molecule with potential applications in research and development.
Formula:C13H11ClN2OS
InChI:InChI=1S/C13H11ClN2OS/c14-7-11(17)15-13-16-12-9-4-2-1-3-8(9)5-6-10(12)18-13/h1-4H,5-7H2,(H,15,16,17)
InChI key:InChIKey=GLDTTYASZNAWDG-UHFFFAOYSA-N
SMILES:N(C(CCl)=O)C1=NC=2C=3C(CCC2S1)=CC=CC3
Synonyms:- 2-Chloro-N-(4,5-dihydronaphtho[1,2-d]thiazol-2-yl)acetamide
- Acetamide, 2-chloro-N-(4,5-dihydronaphtho[1,2-d]thiazol-2-yl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.