CAS 91759-32-9
:Thiobarbituric acid
Description:
Thiobarbituric acid is a heterocyclic compound that belongs to the barbiturate family, characterized by its thiol group (-SH) substitution on the barbituric acid structure. It is typically a white to off-white crystalline solid that is soluble in water and polar organic solvents. The compound exhibits acidic properties due to the presence of the carboxylic acid functional group, allowing it to participate in various chemical reactions, including esterification and condensation. Thiobarbituric acid is known for its role in biochemical assays, particularly in the detection of malondialdehyde, a marker of oxidative stress. Its reactivity is influenced by the electron-withdrawing nature of the thiol group, which can affect its stability and interaction with other molecules. Additionally, thiobarbituric acid can form complexes with metal ions, which may have implications in biological systems and analytical chemistry. Overall, its unique structural features and reactivity make thiobarbituric acid a valuable compound in both research and clinical applications.
Formula:C4H4N2O2S
InChI:InChI=1S/C4H4N2O2S/c7-2-1-3(8)6-4(9)5-2/h1H2,(H2,5,6,7,8,9)
InChI key:InChIKey=RVBUGGBMJDPOST-UHFFFAOYSA-N
SMILES:O=C1CC(=O)NC(=S)N1
Synonyms:- Thiobarbituric acid
- 4,6(1H,5H)-Pyrimidinedione, dihydro-2-thioxo-
- Barbituric acid, 2-thio-
- 2-Thiobarbituric acid
- Dihydro-2-thioxo-4,6(1H,5H)-pyrimidinedione
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
