CAS 91759-61-4

[5-(3,4-dimethoxyphenyl)-2H-tetrazol-2-yl]acetic acid

Description:

[5-(3,4-Dimethoxyphenyl)-2H-tetrazol-2-yl]acetic acid is a chemical compound characterized by its tetrazole ring, which is a five-membered heterocyclic structure containing four nitrogen atoms and one carbon atom. This compound features a phenyl group substituted with two methoxy groups at the 3 and 4 positions, enhancing its lipophilicity and potentially influencing its biological activity. The acetic acid moiety contributes to its acidity and solubility in polar solvents. The presence of the tetrazole ring often imparts unique pharmacological properties, making such compounds of interest in medicinal chemistry for their potential therapeutic applications. The compound's molecular structure suggests it may participate in hydrogen bonding due to the carboxylic acid group, which can affect its interactions with biological targets. Overall, [5-(3,4-dimethoxyphenyl)-2H-tetrazol-2-yl]acetic acid is a complex organic molecule with potential utility in various chemical and pharmaceutical contexts.

Formula: C₁₁H₁₂N₄O₄

InChI: InChI=1/C11H12N4O4/c1-18-8-4-3-7(5-9(8)19-2)11-12-14-15(13-11)6-10(16)17/h3-5H,6H2,1-2H3,(H,16,17)

SMILES: COc1ccc(cc1OC)c1nnn(CC(=O)O)n1

Synonyms:

• 2H-tetrazole-2-acetic acid, 5-(3,4-dimethoxyphenyl)-

[5-(3,4-Dimethoxyphenyl)-2H-tetrazol-2-yl]acetic acid

CAS: 91759-61-4

Versatile small molecule scaffold

Formula: C₁₁H₁₂N₄O₄

Purity: Min. 95%

Molecular weight: 264.24 g/mol

Ref: 3D-RDA75961