CAS 91759-68-1

5-(4-methoxyphenyl)-4-phenyl-2,4-dihydro-3H-1,2,4-triazole-3-thione

Description:

5-(4-Methoxyphenyl)-4-phenyl-2,4-dihydro-3H-1,2,4-triazole-3-thione is a chemical compound characterized by its triazole ring structure, which is a five-membered heterocycle containing three nitrogen atoms. This compound features a thione functional group, indicating the presence of a sulfur atom double-bonded to a carbon atom within the triazole framework. The presence of the 4-methoxyphenyl and phenyl substituents contributes to its aromatic character and may influence its solubility and reactivity. Typically, compounds of this nature exhibit biological activity, making them of interest in medicinal chemistry and drug development. The molecular structure suggests potential interactions with biological targets, possibly leading to pharmacological effects. Additionally, the compound's stability, solubility, and reactivity can be influenced by the substituents on the triazole ring, which may also affect its synthesis and application in various chemical contexts. Overall, this compound represents a class of heterocyclic compounds with diverse applications in research and industry.

Formula: C₁₅H₁₃N₃OS

InChI: InChI=1/C15H13N3OS/c1-19-13-9-7-11(8-10-13)14-16-17-15(20)18(14)12-5-3-2-4-6-12/h2-10H,1H3,(H,17,20)

SMILES: COc1ccc(cc1)c1nnc(n1c1ccccc1)S

Synonyms:

• 3H-1,2,4-Triazole-3-thione, 2,4-dihydro-5-(4-methoxyphenyl)-4-phenyl-
• 4H-1,2,4-triazole-3-thiol, 5-(4-methoxyphenyl)-4-phenyl-
• 5-(4-Methoxy-phenyl)-4-phenyl-4H-[1,2,4]triazole-3-thiol

5-(4-Methoxy-phenyl)-4-phenyl-4H-[1,2,4]triazole-3-thiol

CAS: 91759-68-1

Purity: 95.0%

Molecular weight: 283.077933036

Ref: 10-F344480