CAS 91767-30-5

2-(4-Chlorophenyl)cyclohexanol

Description:

2-(4-Chlorophenyl)cyclohexanol, with the CAS number 91767-30-5, is an organic compound characterized by its cyclohexanol structure substituted with a 4-chlorophenyl group. This compound typically appears as a solid or viscous liquid, depending on its purity and temperature. It is known for its potential applications in pharmaceuticals and as an intermediate in organic synthesis. The presence of the chlorophenyl group can influence its chemical reactivity and biological activity, often enhancing lipophilicity and altering solubility in various solvents. The hydroxyl (-OH) group in cyclohexanol contributes to its ability to participate in hydrogen bonding, affecting its physical properties such as boiling point and melting point. Additionally, the compound may exhibit specific stereochemistry due to the cyclohexane ring, which can lead to different conformations. Safety data should be consulted for handling and exposure risks, as with any chemical substance. Overall, 2-(4-Chlorophenyl)cyclohexanol is a notable compound in the realm of organic chemistry with various potential applications.

Formula: C₁₂H₁₅ClO

InChI: InChI=1S/C12H15ClO/c13-10-7-5-9(6-8-10)11-3-1-2-4-12(11)14/h5-8,11-12,14H,1-4H2

InChI key: InChIKey=IJTCXAWGMMJYLJ-UHFFFAOYSA-N

SMILES: OC1C(C2=CC=C(Cl)C=C2)CCCC1

Synonyms:

• Cyclohexanol, 2-(p-chlorophenyl)-
• 2-(4-Chlorophenyl)cyclohexanol
• 2-(4-Chlorophenyl)cyclohexan-1-ol
• Cyclohexanol, 2-(4-chlorophenyl)-