
CAS 91772-19-9
:4-(1,2,3,4-Thiatriazol-5-ylamino)benzenesulfonamide
Description:
4-(1,2,3,4-Thiatriazol-5-ylamino)benzenesulfonamide, with the CAS number 91772-19-9, is a chemical compound that features a sulfonamide functional group attached to a benzene ring, along with a thiatriazole moiety. This compound is characterized by its potential biological activity, particularly in medicinal chemistry, where sulfonamides are known for their antibacterial properties. The presence of the thiatriazole ring may contribute to its pharmacological profile, possibly enhancing its interaction with biological targets. The compound is typically a solid at room temperature and may exhibit solubility in polar solvents, depending on its specific structure and substituents. Its synthesis often involves multi-step organic reactions, and it may be utilized in various applications, including drug development and research into new therapeutic agents. As with many sulfonamides, it is essential to consider its safety profile, including potential toxicity and environmental impact, during handling and application.
Formula:C7H7N5O2S2
InChI:InChI=1S/C7H7N5O2S2/c8-16(13,14)6-3-1-5(2-4-6)9-7-10-11-12-15-7/h1-4H,(H2,8,13,14)(H,9,10,12)
InChI key:InChIKey=CQVTZJHGUVERRB-UHFFFAOYSA-N
SMILES:N(C1=CC=C(S(N)(=O)=O)C=C1)C2=NN=NS2
Synonyms:- 1,2,3,4-Thiatriazole, benzenesulfonamide deriv.
- 4-(1,2,3,4-Thiatriazol-5-ylamino)benzenesulfonamide
- Sulfanilamide, N4-1,2,3,4-thiatriazol-5-yl-
- Benzenesulfonamide, 4-(1,2,3,4-thiatriazol-5-ylamino)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
m-(1,2,3,4-Thiatriazol-5-ylamino)benzenesulphonamide
CAS:m-(1,2,3,4-Thiatriazol-5-ylamino)benzenesulphonamide is a bioactive chemical.Formula:C7H7N5O2S2Color and Shape:SolidMolecular weight:257.29
