CAS 917746-30-6

3-Ethyl-6,7-dimethyl-2(1H)-quinolinethione

Description:

3-Ethyl-6,7-dimethyl-2(1H)-quinolinethione is a heterocyclic organic compound characterized by its quinoline structure, which features a nitrogen atom within a bicyclic aromatic system. This compound contains a thione functional group, indicating the presence of a sulfur atom double-bonded to a carbon atom, which contributes to its reactivity and potential biological activity. The ethyl and two methyl substituents on the quinoline ring influence its solubility, stability, and interaction with biological systems. Typically, compounds of this nature may exhibit various pharmacological properties, making them of interest in medicinal chemistry. The presence of the thione group can also affect the compound's electronic properties, potentially enhancing its ability to participate in redox reactions. Additionally, the specific arrangement of substituents can lead to unique steric and electronic characteristics, which may be relevant in the design of derivatives for targeted applications. Overall, 3-Ethyl-6,7-dimethyl-2(1H)-quinolinethione represents a complex structure with potential implications in various fields, including pharmaceuticals and materials science.

Formula: C₁₃H₁₅NS

InChI: InChI=1S/C13H15NS/c1-4-10-7-11-5-8(2)9(3)6-12(11)14-13(10)15/h5-7H,4H2,1-3H3,(H,14,15)

InChI key: InChIKey=GEVPWCXJEDWXAY-UHFFFAOYSA-N

SMILES: C(C)C1=CC=2C(NC1=S)=CC(C)=C(C)C2

Synonyms:

• 2(1H)-Quinolinethione, 3-ethyl-6,7-dimethyl-
• 3-Ethyl-6,7-dimethyl-2(1H)-quinolinethione

3-Ethyl-6,7-dimethyl-quinoline-2-thiol

CAS: 917746-30-6

Formula: C₁₃H₁₅NS

Color and Shape: Solid, Powder

Molecular weight: 217.33

Ref: 10-F060625