
CAS 917746-82-8
:1-[3-(1,5-Dihydro-3-methyl-5-thioxo-4H-1,2,4-triazol-4-yl)propyl]-2-pyrrolidinone
Description:
1-[3-(1,5-Dihydro-3-methyl-5-thioxo-4H-1,2,4-triazol-4-yl)propyl]-2-pyrrolidinone, with the CAS number 917746-82-8, is a chemical compound characterized by its unique structural features, including a pyrrolidinone ring and a triazole moiety. This compound typically exhibits properties such as moderate solubility in polar solvents, which is common for compounds containing nitrogen and sulfur. The presence of the thioxo group suggests potential reactivity, particularly in nucleophilic reactions, while the triazole ring may contribute to biological activity, possibly as a bioactive agent or pharmaceutical intermediate. The compound's molecular structure indicates it may participate in hydrogen bonding, influencing its interactions in biological systems. Additionally, its potential applications could span various fields, including medicinal chemistry and agrochemicals, due to the presence of both heterocyclic and functional groups that are often associated with diverse biological activities. Further studies would be necessary to fully elucidate its properties and potential uses.
Formula:C10H16N4OS
InChI:InChI=1S/C10H16N4OS/c1-8-11-12-10(16)14(8)7-3-6-13-5-2-4-9(13)15/h2-7H2,1H3,(H,12,16)
InChI key:InChIKey=WZGPULXWHVDENL-UHFFFAOYSA-N
SMILES:C(CCN1C(=O)CCC1)N2C(C)=NNC2=S
Synonyms:- 1-[3-(1,5-Dihydro-3-methyl-5-thioxo-4H-1,2,4-triazol-4-yl)propyl]-2-pyrrolidinone
- 2-Pyrrolidinone, 1-[3-(1,5-dihydro-3-methyl-5-thioxo-4H-1,2,4-triazol-4-yl)propyl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.