CAS 917746-84-0

3,7-Dimethyl-2(1H)-quinolinethione

Description:

3,7-Dimethyl-2(1H)-quinolinethione is an organic compound characterized by its quinoline structure, which features a nitrogen atom within a bicyclic aromatic system. This compound contains a thione functional group, indicating the presence of a sulfur atom double-bonded to a carbon atom, which contributes to its reactivity and potential applications in various chemical reactions. The presence of two methyl groups at the 3 and 7 positions of the quinoline ring influences its physical and chemical properties, such as solubility and stability. Typically, compounds like this may exhibit biological activity, making them of interest in medicinal chemistry and drug development. Additionally, the compound's unique structure may allow for interactions with biological targets, potentially leading to therapeutic effects. Its CAS number, 917746-84-0, serves as a unique identifier for regulatory and research purposes, facilitating the tracking of its properties and applications in scientific literature. Overall, 3,7-Dimethyl-2(1H)-quinolinethione represents a fascinating area of study within organic and medicinal chemistry.

Formula: C₁₁H₁₁NS

InChI: InChI=1S/C11H11NS/c1-7-3-4-9-6-8(2)11(13)12-10(9)5-7/h3-6H,1-2H3,(H,12,13)

InChI key: InChIKey=KSKDPXCBQGPRJE-UHFFFAOYSA-N

SMILES: S=C1NC=2C(C=C1C)=CC=C(C)C2

Synonyms:

• 2(1H)-Quinolinethione, 3,7-dimethyl-
• 3,7-Dimethyl-2(1H)-quinolinethione