CAS 917747-48-9

N-[4-[4-(4-Ethylphenyl)-4,5-dihydro-5-thioxo-1H-1,2,4-triazol-3-yl]phenyl]benzenesulfonamide

Description:

N-[4-[4-(4-Ethylphenyl)-4,5-dihydro-5-thioxo-1H-1,2,4-triazol-3-yl]phenyl]benzenesulfonamide is a chemical compound characterized by its complex structure, which includes a sulfonamide group and a triazole moiety. The presence of the thioxo group contributes to its potential reactivity and biological activity. This compound is likely to exhibit properties typical of sulfonamides, such as antibacterial activity, although specific biological activities would depend on its precise molecular interactions. The ethylphenyl substituent may influence its lipophilicity and solubility, affecting its pharmacokinetic properties. Additionally, the triazole ring is known for its role in various medicinal applications, including antifungal and anticancer activities. The compound's molecular weight, solubility, and stability would be influenced by its functional groups and overall structure. As with many synthetic compounds, safety and handling precautions are essential, particularly due to potential toxicity associated with certain functional groups. Further studies would be necessary to fully elucidate its properties and potential applications in pharmaceuticals or other fields.

Formula: C₂₂H₂₀N₄O₂S₂

InChI: InChI=1S/C22H20N4O2S2/c1-2-16-8-14-19(15-9-16)26-21(23-24-22(26)29)17-10-12-18(13-11-17)25-30(27,28)20-6-4-3-5-7-20/h3-15,25H,2H2,1H3,(H,24,29)

InChI key: InChIKey=UHPQXCUKRMUCLH-UHFFFAOYSA-N

SMILES: S=C1N(C(=NN1)C2=CC=C(NS(=O)(=O)C3=CC=CC=C3)C=C2)C4=CC=C(CC)C=C4

Synonyms:

• Benzenesulfonamide, N-[4-[4-(4-ethylphenyl)-4,5-dihydro-5-thioxo-1H-1,2,4-triazol-3-yl]phenyl]-
• N-[4-[4-(4-Ethylphenyl)-4,5-dihydro-5-thioxo-1H-1,2,4-triazol-3-yl]phenyl]benzenesulfonamide